C10H15BrCl2N2 — CID 45260144
2-N,2-N-bis(2-chloroethyl)benzene-1,2-diamine;hydrobromide (PubChem CID 45260144) has the molecular formula C10H15BrCl2N2 and a molecular weight of 314.05 g/mol. Its IUPAC name is 2-N,2-N-bis(2-chloroethyl)benzene-1,2-diamine;hydrobromide.
| Compound Name | 2-N,2-N-bis(2-chloroethyl)benzene-1,2-diamine;hydrobromide |
|---|---|
| PubChem CID | 45260144 |
| Molecular Formula | C10H15BrCl2N2 |
| Molecular Weight | 314.05 g/mol |
| Exact Mass | 311.98 |
| IUPAC Name | 2-N,2-N-bis(2-chloroethyl)benzene-1,2-diamine;hydrobromide |
| SMILES | Br.Nc1ccccc1N(CCCl)CCCl |
| InChI | InChI=1S/C10H14Cl2N2.BrH/c11-5-7-14(8-6-12)10-4-2-1-3-9(10)13;/h1-4H,5-8,13H2;1H |
| InChIKey | OHXGYDTVOQTHRS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.05 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|