C9H14ClN3 — CID 82506047
1-N-(2-aminoethyl)-2-chloro-1-N-methylbenzene-1,4-diamine (PubChem CID 82506047) has the molecular formula C9H14ClN3 and a molecular weight of 199.69 g/mol. Its IUPAC name is 1-N-(2-aminoethyl)-2-chloro-1-N-methylbenzene-1,4-diamine.
| Compound Name | 1-N-(2-aminoethyl)-2-chloro-1-N-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 82506047 |
| Molecular Formula | C9H14ClN3 |
| Molecular Weight | 199.69 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 1-N-(2-aminoethyl)-2-chloro-1-N-methylbenzene-1,4-diamine |
| SMILES | CN(CCN)c1ccc(N)cc1Cl |
| InChI | InChI=1S/C9H14ClN3/c1-13(5-4-11)9-3-2-7(12)6-8(9)10/h2-3,6H,4-5,11-12H2,1H3 |
| InChIKey | XNLTXZQUKABHPJ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.69 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|