C12H18Cl2N2 — CID 115200543
1-N-(2,4-dichlorophenyl)-1-N,3-dimethylbutane-1,3-diamine (PubChem CID 115200543) has the molecular formula C12H18Cl2N2 and a molecular weight of 261.20 g/mol. Its IUPAC name is 1-N-(2,4-dichlorophenyl)-1-N,3-dimethylbutane-1,3-diamine.
| Compound Name | 1-N-(2,4-dichlorophenyl)-1-N,3-dimethylbutane-1,3-diamine |
|---|---|
| PubChem CID | 115200543 |
| Molecular Formula | C12H18Cl2N2 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 1-N-(2,4-dichlorophenyl)-1-N,3-dimethylbutane-1,3-diamine |
| SMILES | CN(CCC(C)(C)N)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H18Cl2N2/c1-12(2,15)6-7-16(3)11-5-4-9(13)8-10(11)14/h4-5,8H,6-7,15H2,1-3H3 |
| InChIKey | RHEDCKGIGTWBGV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |