C9H8Cl2N2 — CID 82113638
2-(2,4-dichloro-N-methylanilino)acetonitrile (PubChem CID 82113638) has the molecular formula C9H8Cl2N2 and a molecular weight of 215.08 g/mol. Its IUPAC name is 2-(2,4-dichloro-N-methylanilino)acetonitrile.
| Compound Name | 2-(2,4-dichloro-N-methylanilino)acetonitrile |
|---|---|
| PubChem CID | 82113638 |
| Molecular Formula | C9H8Cl2N2 |
| Molecular Weight | 215.08 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | 2-(2,4-dichloro-N-methylanilino)acetonitrile |
| SMILES | CN(CC#N)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H8Cl2N2/c1-13(5-4-12)9-3-2-7(10)6-8(9)11/h2-3,6H,5H2,1H3 |
| InChIKey | OGGIAFZAJNZHEP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.08 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|