C8H7Cl2NO — CID 87333606
N-(2,4-dichlorophenyl)-N-methylformamide (PubChem CID 87333606) has the molecular formula C8H7Cl2NO and a molecular weight of 204.06 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-N-methylformamide.
| Compound Name | N-(2,4-dichlorophenyl)-N-methylformamide |
|---|---|
| PubChem CID | 87333606 |
| Molecular Formula | C8H7Cl2NO |
| Molecular Weight | 204.06 g/mol |
| Exact Mass | 202.99 |
| IUPAC Name | N-(2,4-dichlorophenyl)-N-methylformamide |
| SMILES | CN(C=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H7Cl2NO/c1-11(5-12)8-3-2-6(9)4-7(8)10/h2-5H,1H3 |
| InChIKey | LSAOEKNBVHWVAN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.06 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|