C11H10Cl2N2O — CID 115173703
3-cyano-N-(2,4-dichlorophenyl)-N-methylpropanamide (PubChem CID 115173703) has the molecular formula C11H10Cl2N2O and a molecular weight of 257.12 g/mol. Its IUPAC name is 3-cyano-N-(2,4-dichlorophenyl)-N-methylpropanamide.
| Compound Name | 3-cyano-N-(2,4-dichlorophenyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 115173703 |
| Molecular Formula | C11H10Cl2N2O |
| Molecular Weight | 257.12 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 3-cyano-N-(2,4-dichlorophenyl)-N-methylpropanamide |
| SMILES | CN(C(=O)CCC#N)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H10Cl2N2O/c1-15(11(16)3-2-6-14)10-5-4-8(12)7-9(10)13/h4-5,7H,2-3H2,1H3 |
| InChIKey | ISYJOMATYOBZOB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.12 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |