C10H11ClN2 — CID 82112115
2-(3-chloro-N,4-dimethylanilino)acetonitrile (PubChem CID 82112115) has the molecular formula C10H11ClN2 and a molecular weight of 194.66 g/mol. Its IUPAC name is 2-(3-chloro-N,4-dimethylanilino)acetonitrile.
| Compound Name | 2-(3-chloro-N,4-dimethylanilino)acetonitrile |
|---|---|
| PubChem CID | 82112115 |
| Molecular Formula | C10H11ClN2 |
| Molecular Weight | 194.66 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 2-(3-chloro-N,4-dimethylanilino)acetonitrile |
| SMILES | Cc1ccc(N(C)CC#N)cc1Cl |
| InChI | InChI=1S/C10H11ClN2/c1-8-3-4-9(7-10(8)11)13(2)6-5-12/h3-4,7H,6H2,1-2H3 |
| InChIKey | ZOSWXSBRFXZKHQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.66 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|