C13H18N2 — CID 115130881
2-(N,2-dimethyl-5-propan-2-ylanilino)acetonitrile (PubChem CID 115130881) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 2-(N,2-dimethyl-5-propan-2-ylanilino)acetonitrile.
| Compound Name | 2-(N,2-dimethyl-5-propan-2-ylanilino)acetonitrile |
|---|---|
| PubChem CID | 115130881 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 2-(N,2-dimethyl-5-propan-2-ylanilino)acetonitrile |
| SMILES | Cc1ccc(C(C)C)cc1N(C)CC#N |
| InChI | InChI=1S/C13H18N2/c1-10(2)12-6-5-11(3)13(9-12)15(4)8-7-14/h5-6,9-10H,8H2,1-4H3 |
| InChIKey | IFJTVBAHCPZOHY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|