C12H18ClN — CID 115262883
N-(chloromethyl)-N,2-dimethyl-5-propan-2-ylaniline (PubChem CID 115262883) has the molecular formula C12H18ClN and a molecular weight of 211.74 g/mol. Its IUPAC name is N-(chloromethyl)-N,2-dimethyl-5-propan-2-ylaniline.
| Compound Name | N-(chloromethyl)-N,2-dimethyl-5-propan-2-ylaniline |
|---|---|
| PubChem CID | 115262883 |
| Molecular Formula | C12H18ClN |
| Molecular Weight | 211.74 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | N-(chloromethyl)-N,2-dimethyl-5-propan-2-ylaniline |
| SMILES | Cc1ccc(C(C)C)cc1N(C)CCl |
| InChI | InChI=1S/C12H18ClN/c1-9(2)11-6-5-10(3)12(7-11)14(4)8-13/h5-7,9H,8H2,1-4H3 |
| InChIKey | HIWSNLDIWBBAEA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.74 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|