C11H11N3O — CID 115130898
2-[methyl-(2-methyl-1,3-benzoxazol-6-yl)amino]acetonitrile (PubChem CID 115130898) has the molecular formula C11H11N3O and a molecular weight of 201.23 g/mol. Its IUPAC name is 2-[methyl-(2-methyl-1,3-benzoxazol-6-yl)amino]acetonitrile.
| Compound Name | 2-[methyl-(2-methyl-1,3-benzoxazol-6-yl)amino]acetonitrile |
|---|---|
| PubChem CID | 115130898 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 2-[methyl-(2-methyl-1,3-benzoxazol-6-yl)amino]acetonitrile |
| SMILES | Cc1nc2ccc(N(C)CC#N)cc2o1 |
| InChI | InChI=1S/C11H11N3O/c1-8-13-10-4-3-9(7-11(10)15-8)14(2)6-5-12/h3-4,7H,6H2,1-2H3 |
| InChIKey | PNOBJQFSSSDGCJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 53.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|