C20H30Cl2N4O — CID 70132443
2-(4-amino-2-chloro-N-methylanilino)ethanol;2-chloro-1-N-methyl-1-N-(2-methylpropyl)benzene-1,4-diamine (PubChem CID 70132443) has the molecular formula C20H30Cl2N4O and a molecular weight of 413.39 g/mol. Its IUPAC name is 2-(4-amino-2-chloro-N-methylanilino)ethanol;2-chloro-1-N-methyl-1-N-(2-methylpropyl)benzene-1,4-diamine.
| Compound Name | 2-(4-amino-2-chloro-N-methylanilino)ethanol;2-chloro-1-N-methyl-1-N-(2-methylpropyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 70132443 |
| Molecular Formula | C20H30Cl2N4O |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 2-(4-amino-2-chloro-N-methylanilino)ethanol;2-chloro-1-N-methyl-1-N-(2-methylpropyl)benzene-1,4-diamine |
| SMILES | CC(C)CN(C)c1ccc(N)cc1Cl.CN(CCO)c1ccc(N)cc1Cl |
| InChI | InChI=1S/C11H17ClN2.C9H13ClN2O/c1-8(2)7-14(3)11-5-4-9(13)6-10(11)12;1-12(4-5-13)9-3-2-7(11)6-8(9)10/h4-6,8H,7,13H2,1-3H3;2-3,6,13H,4-5,11H2,1H3 |
| InChIKey | CWIWEMQOYJJUOY-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 78.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|