C7H15F2N3 — CID 177328079
(Z)-3-[amino(propan-2-yl)amino]-1,1-difluorobut-2-en-2-amine (PubChem CID 177328079) has the molecular formula C7H15F2N3 and a molecular weight of 179.21 g/mol. Its IUPAC name is (Z)-3-[amino(propan-2-yl)amino]-1,1-difluorobut-2-en-2-amine.
| Compound Name | (Z)-3-[amino(propan-2-yl)amino]-1,1-difluorobut-2-en-2-amine |
|---|---|
| PubChem CID | 177328079 |
| Molecular Formula | C7H15F2N3 |
| Molecular Weight | 179.21 g/mol |
| Exact Mass | 179.12 |
| IUPAC Name | (Z)-3-[amino(propan-2-yl)amino]-1,1-difluorobut-2-en-2-amine |
| SMILES | C/C(=C(/N)C(F)F)N(N)C(C)C |
| InChI | InChI=1S/C7H15F2N3/c1-4(2)12(11)5(3)6(10)7(8)9/h4,7H,10-11H2,1-3H3/b6-5- |
| InChIKey | MIYIETIGYGDBHR-WAYWQWQTSA-N |
| XLogP | 1.03 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.21 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|