About acetamide;N-ethyl-N-propan-2-ylpropan-2-amine
acetamide;N-ethyl-N-propan-2-ylpropan-2-amine (PubChem CID 158250626) has the molecular formula C10H24N2O
and a molecular weight of 188.31 g/mol. Its IUPAC name is acetamide;N-ethyl-N-propan-2-ylpropan-2-amine.
Molecular Properties
| Compound Name | acetamide;N-ethyl-N-propan-2-ylpropan-2-amine |
| PubChem CID | 158250626 |
| Molecular Formula | C10H24N2O |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.19 |
| IUPAC Name | acetamide;N-ethyl-N-propan-2-ylpropan-2-amine |
| SMILES | CC(N)=O.CCN(C(C)C)C(C)C |
| InChI | InChI=1S/C8H19N.C2H5NO/c1-6-9(7(2)3)8(4)5;1-2(3)4/h7-8H,6H2,1-5H3;1H3,(H2,3,4) |
| InChIKey | GGRAKKXIEKADPO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze acetamide;N-ethyl-N-propan-2-ylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;N-ethyl-N-propan-2-ylpropan-2-amine?
The IUPAC name of acetamide;N-ethyl-N-propan-2-ylpropan-2-amine (CID 158250626) is acetamide;N-ethyl-N-propan-2-ylpropan-2-amine.
What is the SMILES notation for acetamide;N-ethyl-N-propan-2-ylpropan-2-amine?
The canonical SMILES for acetamide;N-ethyl-N-propan-2-ylpropan-2-amine is CC(N)=O.CCN(C(C)C)C(C)C.
What is the InChIKey of acetamide;N-ethyl-N-propan-2-ylpropan-2-amine?
The InChIKey is GGRAKKXIEKADPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N.C2H5NO/c1-6-9(7(2)3)8(4)5;1-2(3)4/h7-8H,6H2,1-5H3;1H3,(H2,3,4).
What are the key properties of acetamide;N-ethyl-N-propan-2-ylpropan-2-amine?
acetamide;N-ethyl-N-propan-2-ylpropan-2-amine has a molecular weight of 188.31 g/mol, XLogP of 1.62, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;N-ethyl-N-propan-2-ylpropan-2-amine is sourced from PubChem (CID 158250626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).