About bis(N-ethyl-N-propan-2-ylpropan-2-amine);hydrofluoride
bis(N-ethyl-N-propan-2-ylpropan-2-amine);hydrofluoride (PubChem CID 159245549) has the molecular formula C16H39FN2
and a molecular weight of 278.50 g/mol. Its IUPAC name is bis(N-ethyl-N-propan-2-ylpropan-2-amine);hydrofluoride.
Molecular Properties
| Compound Name | bis(N-ethyl-N-propan-2-ylpropan-2-amine);hydrofluoride |
| PubChem CID | 159245549 |
| Molecular Formula | C16H39FN2 |
| Molecular Weight | 278.50 g/mol |
| Exact Mass | 278.31 |
| IUPAC Name | bis(N-ethyl-N-propan-2-ylpropan-2-amine);hydrofluoride |
| SMILES | CCN(C(C)C)C(C)C.CCN(C(C)C)C(C)C.F |
| InChI | InChI=1S/2C8H19N.FH/c2*1-6-9(7(2)3)8(4)5;/h2*7-8H,6H2,1-5H3;1H |
| InChIKey | KUQFISIBZQKKRV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(N-ethyl-N-propan-2-ylpropan-2-amine);hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(N-ethyl-N-propan-2-ylpropan-2-amine);hydrofluoride?
The IUPAC name of bis(N-ethyl-N-propan-2-ylpropan-2-amine);hydrofluoride (CID 159245549) is bis(N-ethyl-N-propan-2-ylpropan-2-amine);hydrofluoride.
What is the SMILES notation for bis(N-ethyl-N-propan-2-ylpropan-2-amine);hydrofluoride?
The canonical SMILES for bis(N-ethyl-N-propan-2-ylpropan-2-amine);hydrofluoride is CCN(C(C)C)C(C)C.CCN(C(C)C)C(C)C.F.
What is the InChIKey of bis(N-ethyl-N-propan-2-ylpropan-2-amine);hydrofluoride?
The InChIKey is KUQFISIBZQKKRV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H19N.FH/c2*1-6-9(7(2)3)8(4)5;/h2*7-8H,6H2,1-5H3;1H.
What are the key properties of bis(N-ethyl-N-propan-2-ylpropan-2-amine);hydrofluoride?
bis(N-ethyl-N-propan-2-ylpropan-2-amine);hydrofluoride has a molecular weight of 278.50 g/mol, XLogP of 4.40, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(N-ethyl-N-propan-2-ylpropan-2-amine);hydrofluoride is sourced from PubChem (CID 159245549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).