About Lithium diisopropylethylamine
Lithium diisopropylethylamine (PubChem CID 86615685) has the molecular formula C8H19LiN
and a molecular weight of 136.19 g/mol.
Molecular Properties
| Compound Name | Lithium diisopropylethylamine |
| PubChem CID | 86615685 |
| Molecular Formula | C8H19LiN |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.17 |
| IUPAC Name | — |
| SMILES | CCN(C(C)C)C(C)C.[Li] |
| InChI | InChI=1S/C8H19N.Li/c1-6-9(7(2)3)8(4)5;/h7-8H,6H2,1-5H3; |
| InChIKey | PIPCLYKAMNKGKU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze Lithium diisopropylethylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Lithium diisopropylethylamine?
The IUPAC name of Lithium diisopropylethylamine (CID 86615685) is not available.
What is the SMILES notation for Lithium diisopropylethylamine?
The canonical SMILES for Lithium diisopropylethylamine is CCN(C(C)C)C(C)C.[Li].
What is the InChIKey of Lithium diisopropylethylamine?
The InChIKey is PIPCLYKAMNKGKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N.Li/c1-6-9(7(2)3)8(4)5;/h7-8H,6H2,1-5H3;.
What are the key properties of Lithium diisopropylethylamine?
Lithium diisopropylethylamine has a molecular weight of 136.19 g/mol, XLogP of 1.74, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Lithium diisopropylethylamine is sourced from PubChem (CID 86615685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).