About ethenone;N-ethyl-N-propan-2-ylpropan-2-amine
ethenone;N-ethyl-N-propan-2-ylpropan-2-amine (PubChem CID 91070858) has the molecular formula C10H21NO
and a molecular weight of 171.28 g/mol. Its IUPAC name is ethenone;N-ethyl-N-propan-2-ylpropan-2-amine.
Molecular Properties
| Compound Name | ethenone;N-ethyl-N-propan-2-ylpropan-2-amine |
| PubChem CID | 91070858 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | ethenone;N-ethyl-N-propan-2-ylpropan-2-amine |
| SMILES | C=C=O.CCN(C(C)C)C(C)C |
| InChI | InChI=1S/C8H19N.C2H2O/c1-6-9(7(2)3)8(4)5;1-2-3/h7-8H,6H2,1-5H3;1H2 |
| InChIKey | DVVNOEPDHVBQNA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze ethenone;N-ethyl-N-propan-2-ylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenone;N-ethyl-N-propan-2-ylpropan-2-amine?
The IUPAC name of ethenone;N-ethyl-N-propan-2-ylpropan-2-amine (CID 91070858) is ethenone;N-ethyl-N-propan-2-ylpropan-2-amine.
What is the SMILES notation for ethenone;N-ethyl-N-propan-2-ylpropan-2-amine?
The canonical SMILES for ethenone;N-ethyl-N-propan-2-ylpropan-2-amine is C=C=O.CCN(C(C)C)C(C)C.
What is the InChIKey of ethenone;N-ethyl-N-propan-2-ylpropan-2-amine?
The InChIKey is DVVNOEPDHVBQNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N.C2H2O/c1-6-9(7(2)3)8(4)5;1-2-3/h7-8H,6H2,1-5H3;1H2.
What are the key properties of ethenone;N-ethyl-N-propan-2-ylpropan-2-amine?
ethenone;N-ethyl-N-propan-2-ylpropan-2-amine has a molecular weight of 171.28 g/mol, XLogP of 2.13, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethenone;N-ethyl-N-propan-2-ylpropan-2-amine is sourced from PubChem (CID 91070858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).