About sodium;N-ethyl-N-propan-2-ylpropan-2-amine;iodide
sodium;N-ethyl-N-propan-2-ylpropan-2-amine;iodide (PubChem CID 174682450) has the molecular formula C8H19INNa
and a molecular weight of 279.14 g/mol. Its IUPAC name is sodium;N-ethyl-N-propan-2-ylpropan-2-amine;iodide.
Molecular Properties
| Compound Name | sodium;N-ethyl-N-propan-2-ylpropan-2-amine;iodide |
| PubChem CID | 174682450 |
| Molecular Formula | C8H19INNa |
| Molecular Weight | 279.14 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | sodium;N-ethyl-N-propan-2-ylpropan-2-amine;iodide |
| SMILES | CCN(C(C)C)C(C)C.[I-].[Na+] |
| InChI | InChI=1S/C8H19N.HI.Na/c1-6-9(7(2)3)8(4)5;;/h7-8H,6H2,1-5H3;1H;/q;;+1/p-1 |
| InChIKey | RPUGEBMVKAXADR-UHFFFAOYSA-M |
| XLogP | -3.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.14 |
| LogP ≤ 5 | -3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze sodium;N-ethyl-N-propan-2-ylpropan-2-amine;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;N-ethyl-N-propan-2-ylpropan-2-amine;iodide?
The IUPAC name of sodium;N-ethyl-N-propan-2-ylpropan-2-amine;iodide (CID 174682450) is sodium;N-ethyl-N-propan-2-ylpropan-2-amine;iodide.
What is the SMILES notation for sodium;N-ethyl-N-propan-2-ylpropan-2-amine;iodide?
The canonical SMILES for sodium;N-ethyl-N-propan-2-ylpropan-2-amine;iodide is CCN(C(C)C)C(C)C.[I-].[Na+].
What is the InChIKey of sodium;N-ethyl-N-propan-2-ylpropan-2-amine;iodide?
The InChIKey is RPUGEBMVKAXADR-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H19N.HI.Na/c1-6-9(7(2)3)8(4)5;;/h7-8H,6H2,1-5H3;1H;/q;;+1/p-1.
What are the key properties of sodium;N-ethyl-N-propan-2-ylpropan-2-amine;iodide?
sodium;N-ethyl-N-propan-2-ylpropan-2-amine;iodide has a molecular weight of 279.14 g/mol, XLogP of -3.87, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;N-ethyl-N-propan-2-ylpropan-2-amine;iodide is sourced from PubChem (CID 174682450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).