About 5,6-dimethyloct-5-en-2-one
5,6-dimethyloct-5-en-2-one (PubChem CID 131227904) has the molecular formula C10H18O
and a molecular weight of 154.25 g/mol. Its IUPAC name is 5,6-dimethyloct-5-en-2-one.
Molecular Properties
| Compound Name | 5,6-dimethyloct-5-en-2-one |
| PubChem CID | 131227904 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | 5,6-dimethyloct-5-en-2-one |
| SMILES | CCC(C)=C(C)CCC(C)=O |
| InChI | InChI=1S/C10H18O/c1-5-8(2)9(3)6-7-10(4)11/h5-7H2,1-4H3 |
| InChIKey | MJVDRPKKGHIYDC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dimethyloct-5-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyloct-5-en-2-one?
The IUPAC name of 5,6-dimethyloct-5-en-2-one (CID 131227904) is 5,6-dimethyloct-5-en-2-one.
What is the SMILES notation for 5,6-dimethyloct-5-en-2-one?
The canonical SMILES for 5,6-dimethyloct-5-en-2-one is CCC(C)=C(C)CCC(C)=O.
What is the InChIKey of 5,6-dimethyloct-5-en-2-one?
The InChIKey is MJVDRPKKGHIYDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O/c1-5-8(2)9(3)6-7-10(4)11/h5-7H2,1-4H3.
What are the key properties of 5,6-dimethyloct-5-en-2-one?
5,6-dimethyloct-5-en-2-one has a molecular weight of 154.25 g/mol, XLogP of 3.10, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyloct-5-en-2-one is sourced from PubChem (CID 131227904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).