C14H26 — CID 14968821
2,3,8,9-tetramethyldeca-2,8-diene (PubChem CID 14968821) has the molecular formula C14H26 and a molecular weight of 194.36 g/mol. Its IUPAC name is 2,3,8,9-tetramethyldeca-2,8-diene.
| Compound Name | 2,3,8,9-tetramethyldeca-2,8-diene |
|---|---|
| PubChem CID | 14968821 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | 2,3,8,9-tetramethyldeca-2,8-diene |
| SMILES | CC(C)=C(C)CCCCC(C)=C(C)C |
| InChI | InChI=1S/C14H26/c1-11(2)13(5)9-7-8-10-14(6)12(3)4/h7-10H2,1-6H3 |
| InChIKey | NYELQATYLVRRIZ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|