C18H42 — CID 163368789
2,3-dimethylhept-2-ene;ethane;2-methylbutane (PubChem CID 163368789) has the molecular formula C18H42 and a molecular weight of 258.53 g/mol. Its IUPAC name is 2,3-dimethylhept-2-ene;ethane;2-methylbutane.
| Compound Name | 2,3-dimethylhept-2-ene;ethane;2-methylbutane |
|---|---|
| PubChem CID | 163368789 |
| Molecular Formula | C18H42 |
| Molecular Weight | 258.53 g/mol |
| Exact Mass | 258.33 |
| IUPAC Name | 2,3-dimethylhept-2-ene;ethane;2-methylbutane |
| SMILES | CC.CC.CCC(C)C.CCCCC(C)=C(C)C |
| InChI | InChI=1S/C9H18.C5H12.2C2H6/c1-5-6-7-9(4)8(2)3;1-4-5(2)3;2*1-2/h5-7H2,1-4H3;5H,4H2,1-3H3;2*1-2H3 |
| InChIKey | RATBBAYUHYZFMN-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.53 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|