C18H36 — CID 169426930
2,3-dimethylhept-2-ene;(Z)-2,3-dimethylhept-3-ene (PubChem CID 169426930) has the molecular formula C18H36 and a molecular weight of 252.49 g/mol. Its IUPAC name is 2,3-dimethylhept-2-ene;(Z)-2,3-dimethylhept-3-ene.
| Compound Name | 2,3-dimethylhept-2-ene;(Z)-2,3-dimethylhept-3-ene |
|---|---|
| PubChem CID | 169426930 |
| Molecular Formula | C18H36 |
| Molecular Weight | 252.49 g/mol |
| Exact Mass | 252.28 |
| IUPAC Name | 2,3-dimethylhept-2-ene;(Z)-2,3-dimethylhept-3-ene |
| SMILES | CCC/C=C(/C)C(C)C.CCCCC(C)=C(C)C |
| InChI | InChI=1S/2C9H18/c2*1-5-6-7-9(4)8(2)3/h5-7H2,1-4H3;7-8H,5-6H2,1-4H3/b;9-7- |
| InChIKey | KWFIBESSDDBMGQ-QFWHIOIXSA-N |
| XLogP | 6.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.49 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|