C10H20O3 — CID 159232241
carbonic acid;2,3-dimethylhept-2-ene (PubChem CID 159232241) has the molecular formula C10H20O3 and a molecular weight of 188.27 g/mol. Its IUPAC name is carbonic acid;2,3-dimethylhept-2-ene.
| Compound Name | carbonic acid;2,3-dimethylhept-2-ene |
|---|---|
| PubChem CID | 159232241 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | carbonic acid;2,3-dimethylhept-2-ene |
| SMILES | CCCCC(C)=C(C)C.O=C(O)O |
| InChI | InChI=1S/C9H18.CH2O3/c1-5-6-7-9(4)8(2)3;2-1(3)4/h5-7H2,1-4H3;(H2,2,3,4) |
| InChIKey | KTAZURJINFCPNQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|