C21H56 — CID 159020428
methane;2,3,7,8-tetramethylnona-2,7-diene (PubChem CID 159020428) has the molecular formula C21H56 and a molecular weight of 308.68 g/mol. Its IUPAC name is methane;2,3,7,8-tetramethylnona-2,7-diene.
| Compound Name | methane;2,3,7,8-tetramethylnona-2,7-diene |
|---|---|
| PubChem CID | 159020428 |
| Molecular Formula | C21H56 |
| Molecular Weight | 308.68 g/mol |
| Exact Mass | 308.44 |
| IUPAC Name | methane;2,3,7,8-tetramethylnona-2,7-diene |
| SMILES | C.C.C.C.C.C.C.C.CC(C)=C(C)CCCC(C)=C(C)C |
| InChI | InChI=1S/C13H24.8CH4/c1-10(2)12(5)8-7-9-13(6)11(3)4;;;;;;;;/h7-9H2,1-6H3;8*1H4 |
| InChIKey | JTPUMGXXZDOXDY-UHFFFAOYSA-N |
| XLogP | 9.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.68 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|