C12H21NO — CID 175606829
N-(4,5-dimethylhex-4-enyl)-2-methylprop-2-enamide (PubChem CID 175606829) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is N-(4,5-dimethylhex-4-enyl)-2-methylprop-2-enamide.
| Compound Name | N-(4,5-dimethylhex-4-enyl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 175606829 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | N-(4,5-dimethylhex-4-enyl)-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCCC(C)=C(C)C |
| InChI | InChI=1S/C12H21NO/c1-9(2)11(5)7-6-8-13-12(14)10(3)4/h3,6-8H2,1-2,4-5H3,(H,13,14) |
| InChIKey | GPOWFNNOLHYEJG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|