C13H20NO2U- — CID 166091369
ethane;(2E,4Z)-2-ethenyl-3-ethyl-N-(oxomethyl)hexa-2,4-dienamide;uranium (PubChem CID 166091369) has the molecular formula C13H20NO2U- and a molecular weight of 460.34 g/mol. Its IUPAC name is ethane;(2E,4Z)-2-ethenyl-3-ethyl-N-(oxomethyl)hexa-2,4-dienamide;uranium.
| Compound Name | ethane;(2E,4Z)-2-ethenyl-3-ethyl-N-(oxomethyl)hexa-2,4-dienamide;uranium |
|---|---|
| PubChem CID | 166091369 |
| Molecular Formula | C13H20NO2U- |
| Molecular Weight | 460.34 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | ethane;(2E,4Z)-2-ethenyl-3-ethyl-N-(oxomethyl)hexa-2,4-dienamide;uranium |
| SMILES | C=C/C(C(=O)N[C-]=O)=C(\C=C/C)CC.CC.[U] |
| InChI | InChI=1S/C11H14NO2.C2H6.U/c1-4-7-9(5-2)10(6-3)11(14)12-8-13;1-2;/h4,6-7H,3,5H2,1-2H3,(H,12,13,14);1-2H3;/q-1;;/b7-4-,10-9+;; |
| InChIKey | FAUJTUVFDUFEST-YZXLICHQSA-N |
| XLogP | 2.66 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|