C9H13NO — CID 145029008
(2Z,3Z,5Z)-2-(1-aminoethylidene)hepta-3,5-dienal (PubChem CID 145029008) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is (2Z,3Z,5Z)-2-(1-aminoethylidene)hepta-3,5-dienal.
| Compound Name | (2Z,3Z,5Z)-2-(1-aminoethylidene)hepta-3,5-dienal |
|---|---|
| PubChem CID | 145029008 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | (2Z,3Z,5Z)-2-(1-aminoethylidene)hepta-3,5-dienal |
| SMILES | C/C=C\C=C/C(C=O)=C(\C)N |
| InChI | InChI=1S/C9H13NO/c1-3-4-5-6-9(7-11)8(2)10/h3-7H,10H2,1-2H3/b4-3-,6-5-,9-8- |
| InChIKey | SRRSYBFJUCJQBH-AAKIXIBCSA-N |
| XLogP | 1.55 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|