C18H22O2 — CID 145266493
(2Z,5Z,6Z,8Z)-5-butan-2-ylidene-2,3-bis(ethenyl)-4-oxodeca-2,6,8-trienal (PubChem CID 145266493) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is (2Z,5Z,6Z,8Z)-5-butan-2-ylidene-2,3-bis(ethenyl)-4-oxodeca-2,6,8-trienal.
| Compound Name | (2Z,5Z,6Z,8Z)-5-butan-2-ylidene-2,3-bis(ethenyl)-4-oxodeca-2,6,8-trienal |
|---|---|
| PubChem CID | 145266493 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | (2Z,5Z,6Z,8Z)-5-butan-2-ylidene-2,3-bis(ethenyl)-4-oxodeca-2,6,8-trienal |
| SMILES | C=C/C(C=O)=C(\C=C)C(=O)C(/C=C\C=C/C)=C(/C)CC |
| InChI | InChI=1S/C18H22O2/c1-6-10-11-12-17(14(5)7-2)18(20)16(9-4)15(8-3)13-19/h6,8-13H,3-4,7H2,1-2,5H3/b10-6-,12-11-,16-15-,17-14- |
| InChIKey | ZGAGKZLVMVMIOW-CPROSWCMSA-N |
| XLogP | 4.28 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|