C12H19NO2 — CID 145145481
ethane;(2Z)-2-ethenyl-3-formyl-N,N-dimethylpenta-2,4-dienamide (PubChem CID 145145481) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is ethane;(2Z)-2-ethenyl-3-formyl-N,N-dimethylpenta-2,4-dienamide.
| Compound Name | ethane;(2Z)-2-ethenyl-3-formyl-N,N-dimethylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 145145481 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | ethane;(2Z)-2-ethenyl-3-formyl-N,N-dimethylpenta-2,4-dienamide |
| SMILES | C=C/C(C=O)=C(\C=C)C(=O)N(C)C.CC |
| InChI | InChI=1S/C10H13NO2.C2H6/c1-5-8(7-12)9(6-2)10(13)11(3)4;1-2/h5-7H,1-2H2,3-4H3;1-2H3/b9-8-; |
| InChIKey | HXUZWAPWMGPMRT-UOQXYWCXSA-N |
| XLogP | 1.97 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|