C10H12ClNO2 — CID 153331395
(2Z)-N-(chloromethyl)-2-ethenyl-3-formyl-N-methylpenta-2,4-dienamide (PubChem CID 153331395) has the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. Its IUPAC name is (2Z)-N-(chloromethyl)-2-ethenyl-3-formyl-N-methylpenta-2,4-dienamide.
| Compound Name | (2Z)-N-(chloromethyl)-2-ethenyl-3-formyl-N-methylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 153331395 |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | (2Z)-N-(chloromethyl)-2-ethenyl-3-formyl-N-methylpenta-2,4-dienamide |
| SMILES | C=C/C(C=O)=C(\C=C)C(=O)N(C)CCl |
| InChI | InChI=1S/C10H12ClNO2/c1-4-8(6-13)9(5-2)10(14)12(3)7-11/h4-6H,1-2,7H2,3H3/b9-8- |
| InChIKey | PLQIWNCZMPNPAG-HJWRWDBZSA-N |
| XLogP | 1.51 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.66 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|