dichloromethane;prop-2-enoic acid

C4H6Cl2O2 — CID 87132958

IUPACdichloromethane;prop-2-enoic acid
SMILESC=CC(=O)O.ClCCl
InChIInChI=1S/C3H4O2.CH2Cl2/c1-2-3(4)5;2-1-3/h2H,1H2,(H,4,5);1H2
InChIKeySZXXRHVWVHHUDO-UHFFFAOYSA-N
MW157.00 g/mol
LogP1.68
Rot. Bonds1

About dichloromethane;prop-2-enoic acid

dichloromethane;prop-2-enoic acid (PubChem CID 87132958) has the molecular formula C4H6Cl2O2 and a molecular weight of 157.00 g/mol. Its IUPAC name is dichloromethane;prop-2-enoic acid.

Molecular Properties

Compound Namedichloromethane;prop-2-enoic acid
PubChem CID87132958
Molecular FormulaC4H6Cl2O2
Molecular Weight157.00 g/mol
Exact Mass155.97
IUPAC Namedichloromethane;prop-2-enoic acid
SMILESC=CC(=O)O.ClCCl
InChIInChI=1S/C3H4O2.CH2Cl2/c1-2-3(4)5;2-1-3/h2H,1H2,(H,4,5);1H2
InChIKeySZXXRHVWVHHUDO-UHFFFAOYSA-N
XLogP1.68
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500157.00
LogP ≤ 51.68
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze dichloromethane;prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of dichloromethane;prop-2-enoic acid?
The IUPAC name of dichloromethane;prop-2-enoic acid (CID 87132958) is dichloromethane;prop-2-enoic acid.
What is the SMILES notation for dichloromethane;prop-2-enoic acid?
The canonical SMILES for dichloromethane;prop-2-enoic acid is C=CC(=O)O.ClCCl.
What is the InChIKey of dichloromethane;prop-2-enoic acid?
The InChIKey is SZXXRHVWVHHUDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4O2.CH2Cl2/c1-2-3(4)5;2-1-3/h2H,1H2,(H,4,5);1H2.
What are the key properties of dichloromethane;prop-2-enoic acid?
dichloromethane;prop-2-enoic acid has a molecular weight of 157.00 g/mol, XLogP of 1.68, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethane;prop-2-enoic acid is sourced from PubChem (CID 87132958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).