About dichloromethane;prop-2-enoic acid
dichloromethane;prop-2-enoic acid (PubChem CID 87132958) has the molecular formula C4H6Cl2O2
and a molecular weight of 157.00 g/mol. Its IUPAC name is dichloromethane;prop-2-enoic acid.
Molecular Properties
| Compound Name | dichloromethane;prop-2-enoic acid |
| PubChem CID | 87132958 |
| Molecular Formula | C4H6Cl2O2 |
| Molecular Weight | 157.00 g/mol |
| Exact Mass | 155.97 |
| IUPAC Name | dichloromethane;prop-2-enoic acid |
| SMILES | C=CC(=O)O.ClCCl |
| InChI | InChI=1S/C3H4O2.CH2Cl2/c1-2-3(4)5;2-1-3/h2H,1H2,(H,4,5);1H2 |
| InChIKey | SZXXRHVWVHHUDO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.00 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dichloromethane;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethane;prop-2-enoic acid?
The IUPAC name of dichloromethane;prop-2-enoic acid (CID 87132958) is dichloromethane;prop-2-enoic acid.
What is the SMILES notation for dichloromethane;prop-2-enoic acid?
The canonical SMILES for dichloromethane;prop-2-enoic acid is C=CC(=O)O.ClCCl.
What is the InChIKey of dichloromethane;prop-2-enoic acid?
The InChIKey is SZXXRHVWVHHUDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4O2.CH2Cl2/c1-2-3(4)5;2-1-3/h2H,1H2,(H,4,5);1H2.
What are the key properties of dichloromethane;prop-2-enoic acid?
dichloromethane;prop-2-enoic acid has a molecular weight of 157.00 g/mol, XLogP of 1.68, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethane;prop-2-enoic acid is sourced from PubChem (CID 87132958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).