C12H20S — CID 142271409
ethane;(1E,3Z,5Z)-1-ethenylsulfanyl-2-methylhepta-1,3,5-triene (PubChem CID 142271409) has the molecular formula C12H20S and a molecular weight of 196.36 g/mol. Its IUPAC name is ethane;(1E,3Z,5Z)-1-ethenylsulfanyl-2-methylhepta-1,3,5-triene.
| Compound Name | ethane;(1E,3Z,5Z)-1-ethenylsulfanyl-2-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 142271409 |
| Molecular Formula | C12H20S |
| Molecular Weight | 196.36 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | ethane;(1E,3Z,5Z)-1-ethenylsulfanyl-2-methylhepta-1,3,5-triene |
| SMILES | C=CS/C=C(C)/C=C\C=C/C.CC |
| InChI | InChI=1S/C10H14S.C2H6/c1-4-6-7-8-10(3)9-11-5-2;1-2/h4-9H,2H2,1,3H3;1-2H3/b6-4-,8-7-,10-9+; |
| InChIKey | DXBHTLXCRQLXRB-BVTZBBLDSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.36 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|