C14H22 — CID 171506572
[(3Z,5Z)-3-propan-2-ylhepta-1,3,5-trien-2-yl]cyclobutane (PubChem CID 171506572) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is [(3Z,5Z)-3-propan-2-ylhepta-1,3,5-trien-2-yl]cyclobutane.
| Compound Name | [(3Z,5Z)-3-propan-2-ylhepta-1,3,5-trien-2-yl]cyclobutane |
|---|---|
| PubChem CID | 171506572 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | [(3Z,5Z)-3-propan-2-ylhepta-1,3,5-trien-2-yl]cyclobutane |
| SMILES | C=C(/C(=C\C=C/C)C(C)C)C1CCC1 |
| InChI | InChI=1S/C14H22/c1-5-6-10-14(11(2)3)12(4)13-8-7-9-13/h5-6,10-11,13H,4,7-9H2,1-3H3/b6-5-,14-10- |
| InChIKey | YAHCSRGPBACJHF-LYVGQXCBSA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|