C11H9FN4S — CID 107546384
2-(4-fluoroanilino)pyrimidine-4-carbothioamide (PubChem CID 107546384) has the molecular formula C11H9FN4S and a molecular weight of 248.29 g/mol. Its IUPAC name is 2-(4-fluoroanilino)pyrimidine-4-carbothioamide.
| Compound Name | 2-(4-fluoroanilino)pyrimidine-4-carbothioamide |
|---|---|
| PubChem CID | 107546384 |
| Molecular Formula | C11H9FN4S |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 2-(4-fluoroanilino)pyrimidine-4-carbothioamide |
| SMILES | NC(=S)c1ccnc(Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C11H9FN4S/c12-7-1-3-8(4-2-7)15-11-14-6-5-9(16-11)10(13)17/h1-6H,(H2,13,17)(H,14,15,16) |
| InChIKey | NCRCGUVASRMTMZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|