C12H10F2N4S2 — CID 107546267
2-[2-(difluoromethylsulfanyl)anilino]pyrimidine-4-carbothioamide (PubChem CID 107546267) has the molecular formula C12H10F2N4S2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 2-[2-(difluoromethylsulfanyl)anilino]pyrimidine-4-carbothioamide.
| Compound Name | 2-[2-(difluoromethylsulfanyl)anilino]pyrimidine-4-carbothioamide |
|---|---|
| PubChem CID | 107546267 |
| Molecular Formula | C12H10F2N4S2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 2-[2-(difluoromethylsulfanyl)anilino]pyrimidine-4-carbothioamide |
| SMILES | NC(=S)c1ccnc(Nc2ccccc2SC(F)F)n1 |
| InChI | InChI=1S/C12H10F2N4S2/c13-11(14)20-9-4-2-1-3-7(9)17-12-16-6-5-8(18-12)10(15)19/h1-6,11H,(H2,15,19)(H,16,17,18) |
| InChIKey | NPWOWEQJFGYSFD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|