C11H10F2N4S — CID 80759668
4-N-[2-(difluoromethylsulfanyl)phenyl]pyrimidine-4,6-diamine (PubChem CID 80759668) has the molecular formula C11H10F2N4S and a molecular weight of 268.29 g/mol. Its IUPAC name is 4-N-[2-(difluoromethylsulfanyl)phenyl]pyrimidine-4,6-diamine.
| Compound Name | 4-N-[2-(difluoromethylsulfanyl)phenyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80759668 |
| Molecular Formula | C11H10F2N4S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 4-N-[2-(difluoromethylsulfanyl)phenyl]pyrimidine-4,6-diamine |
| SMILES | Nc1cc(Nc2ccccc2SC(F)F)ncn1 |
| InChI | InChI=1S/C11H10F2N4S/c12-11(13)18-8-4-2-1-3-7(8)17-10-5-9(14)15-6-16-10/h1-6,11H,(H3,14,15,16,17) |
| InChIKey | CWAZKERIWNXRGF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |