C11H8ClFN4S — CID 107546513
2-(3-chloro-4-fluoroanilino)pyrimidine-4-carbothioamide (PubChem CID 107546513) has the molecular formula C11H8ClFN4S and a molecular weight of 282.73 g/mol. Its IUPAC name is 2-(3-chloro-4-fluoroanilino)pyrimidine-4-carbothioamide.
| Compound Name | 2-(3-chloro-4-fluoroanilino)pyrimidine-4-carbothioamide |
|---|---|
| PubChem CID | 107546513 |
| Molecular Formula | C11H8ClFN4S |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | 2-(3-chloro-4-fluoroanilino)pyrimidine-4-carbothioamide |
| SMILES | NC(=S)c1ccnc(Nc2ccc(F)c(Cl)c2)n1 |
| InChI | InChI=1S/C11H8ClFN4S/c12-7-5-6(1-2-8(7)13)16-11-15-4-3-9(17-11)10(14)18/h1-5H,(H2,14,18)(H,15,16,17) |
| InChIKey | TUHBAPYCWZFJBW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|