C11H6ClFN4 — CID 107543559
2-(3-chloro-4-fluoroanilino)pyrimidine-4-carbonitrile (PubChem CID 107543559) has the molecular formula C11H6ClFN4 and a molecular weight of 248.65 g/mol. Its IUPAC name is 2-(3-chloro-4-fluoroanilino)pyrimidine-4-carbonitrile.
| Compound Name | 2-(3-chloro-4-fluoroanilino)pyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 107543559 |
| Molecular Formula | C11H6ClFN4 |
| Molecular Weight | 248.65 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | 2-(3-chloro-4-fluoroanilino)pyrimidine-4-carbonitrile |
| SMILES | N#Cc1ccnc(Nc2ccc(F)c(Cl)c2)n1 |
| InChI | InChI=1S/C11H6ClFN4/c12-9-5-7(1-2-10(9)13)16-11-15-4-3-8(6-14)17-11/h1-5H,(H,15,16,17) |
| InChIKey | BLJDBRRHHRXECA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.65 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |