C11H7F3N4S — CID 107547329
2-(2,4,5-trifluoroanilino)pyrimidine-4-carbothioamide (PubChem CID 107547329) has the molecular formula C11H7F3N4S and a molecular weight of 284.27 g/mol. Its IUPAC name is 2-(2,4,5-trifluoroanilino)pyrimidine-4-carbothioamide.
| Compound Name | 2-(2,4,5-trifluoroanilino)pyrimidine-4-carbothioamide |
|---|---|
| PubChem CID | 107547329 |
| Molecular Formula | C11H7F3N4S |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 2-(2,4,5-trifluoroanilino)pyrimidine-4-carbothioamide |
| SMILES | NC(=S)c1ccnc(Nc2cc(F)c(F)cc2F)n1 |
| InChI | InChI=1S/C11H7F3N4S/c12-5-3-7(14)9(4-6(5)13)18-11-16-2-1-8(17-11)10(15)19/h1-4H,(H2,15,19)(H,16,17,18) |
| InChIKey | KOJKCNMCHSLQQO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|