C18H19FN4 — CID 143799151
4-N-[(3E,5Z)-7-fluoroocta-1,3,5-trien-4-yl]-2-N-phenylpyrimidine-2,4-diamine (PubChem CID 143799151) has the molecular formula C18H19FN4 and a molecular weight of 310.38 g/mol. Its IUPAC name is 4-N-[(3E,5Z)-7-fluoroocta-1,3,5-trien-4-yl]-2-N-phenylpyrimidine-2,4-diamine.
| Compound Name | 4-N-[(3E,5Z)-7-fluoroocta-1,3,5-trien-4-yl]-2-N-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 143799151 |
| Molecular Formula | C18H19FN4 |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 4-N-[(3E,5Z)-7-fluoroocta-1,3,5-trien-4-yl]-2-N-phenylpyrimidine-2,4-diamine |
| SMILES | C=C/C=C(\C=C/C(C)F)Nc1ccnc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C18H19FN4/c1-3-7-15(11-10-14(2)19)21-17-12-13-20-18(23-17)22-16-8-5-4-6-9-16/h3-14H,1H2,2H3,(H2,20,21,22,23)/b11-10-,15-7+ |
| InChIKey | AYMOULBCAUOFFT-LVDYVNFFSA-N |
| XLogP | 4.62 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|