C16H17NO — CID 144953340
3-ethyl-5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]furo[3,2-b]pyridine (PubChem CID 144953340) has the molecular formula C16H17NO and a molecular weight of 239.32 g/mol. Its IUPAC name is 3-ethyl-5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]furo[3,2-b]pyridine.
| Compound Name | 3-ethyl-5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]furo[3,2-b]pyridine |
|---|---|
| PubChem CID | 144953340 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 3-ethyl-5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]furo[3,2-b]pyridine |
| SMILES | C=C/C(=C\C=C/C)c1ccc2occ(CC)c2n1 |
| InChI | InChI=1S/C16H17NO/c1-4-7-8-12(5-2)14-9-10-15-16(17-14)13(6-3)11-18-15/h4-5,7-11H,2,6H2,1,3H3/b7-4-,12-8+ |
| InChIKey | SCVPGJNIPYWFEU-OTIJGBKASA-N |
| XLogP | 4.54 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|