C10H11NOS — CID 155236407
4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-3H-1,3-oxazole-2-thione (PubChem CID 155236407) has the molecular formula C10H11NOS and a molecular weight of 193.27 g/mol. Its IUPAC name is 4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-3H-1,3-oxazole-2-thione.
| Compound Name | 4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-3H-1,3-oxazole-2-thione |
|---|---|
| PubChem CID | 155236407 |
| Molecular Formula | C10H11NOS |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-3H-1,3-oxazole-2-thione |
| SMILES | C=C/C(=C\C=C/C)c1coc(=S)[nH]1 |
| InChI | InChI=1S/C10H11NOS/c1-3-5-6-8(4-2)9-7-12-10(13)11-9/h3-7H,2H2,1H3,(H,11,13)/b5-3-,8-6+ |
| InChIKey | CDZQPPPWGFYJOC-CUKJDEOPSA-N |
| XLogP | 3.48 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|