C11H13NS — CID 143468750
2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-methyl-1,3-thiazole (PubChem CID 143468750) has the molecular formula C11H13NS and a molecular weight of 191.30 g/mol. Its IUPAC name is 2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-methyl-1,3-thiazole.
| Compound Name | 2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 143468750 |
| Molecular Formula | C11H13NS |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-methyl-1,3-thiazole |
| SMILES | C=C/C(=C\C=C/C)c1nc(C)cs1 |
| InChI | InChI=1S/C11H13NS/c1-4-6-7-10(5-2)11-12-9(3)8-13-11/h4-8H,2H2,1,3H3/b6-4-,10-7+ |
| InChIKey | RFKDVXLPMQNJPK-BSAFSDHNSA-N |
| XLogP | 3.60 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|