C6H7BrClNOS — CID 121225631
2-bromo-1-(4-methyl-1,3-thiazol-2-yl)ethanone;hydrochloride (PubChem CID 121225631) has the molecular formula C6H7BrClNOS and a molecular weight of 256.55 g/mol. Its IUPAC name is 2-bromo-1-(4-methyl-1,3-thiazol-2-yl)ethanone;hydrochloride.
| Compound Name | 2-bromo-1-(4-methyl-1,3-thiazol-2-yl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 121225631 |
| Molecular Formula | C6H7BrClNOS |
| Molecular Weight | 256.55 g/mol |
| Exact Mass | 254.91 |
| IUPAC Name | 2-bromo-1-(4-methyl-1,3-thiazol-2-yl)ethanone;hydrochloride |
| SMILES | Cc1csc(C(=O)CBr)n1.Cl |
| InChI | InChI=1S/C6H6BrNOS.ClH/c1-4-3-10-6(8-4)5(9)2-7;/h3H,2H2,1H3;1H |
| InChIKey | AVXRKESGISFPRG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.55 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|