C11H16N2OS — CID 110696169
azepan-1-yl-(4-methyl-1,3-thiazol-2-yl)methanone (PubChem CID 110696169) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is azepan-1-yl-(4-methyl-1,3-thiazol-2-yl)methanone.
| Compound Name | azepan-1-yl-(4-methyl-1,3-thiazol-2-yl)methanone |
|---|---|
| PubChem CID | 110696169 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | azepan-1-yl-(4-methyl-1,3-thiazol-2-yl)methanone |
| SMILES | Cc1csc(C(=O)N2CCCCCC2)n1 |
| InChI | InChI=1S/C11H16N2OS/c1-9-8-15-10(12-9)11(14)13-6-4-2-3-5-7-13/h8H,2-7H2,1H3 |
| InChIKey | OTAHYXXJZMYABB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |