C10H14N2OS — CID 67514784
(4-methyl-1,3-thiazol-2-yl)-piperidin-1-ylmethanone (PubChem CID 67514784) has the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. Its IUPAC name is (4-methyl-1,3-thiazol-2-yl)-piperidin-1-ylmethanone.
| Compound Name | (4-methyl-1,3-thiazol-2-yl)-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 67514784 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | (4-methyl-1,3-thiazol-2-yl)-piperidin-1-ylmethanone |
| SMILES | Cc1csc(C(=O)N2CCCCC2)n1 |
| InChI | InChI=1S/C10H14N2OS/c1-8-7-14-9(11-8)10(13)12-5-3-2-4-6-12/h7H,2-6H2,1H3 |
| InChIKey | ZOBQSLDGYILVDP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |