C6H7AgN3O2S — CID 135519768
2-hydroxyimino-2-(4-methyl-1,3-thiazol-2-yl)acetamide;silver (PubChem CID 135519768) has the molecular formula C6H7AgN3O2S and a molecular weight of 293.08 g/mol. Its IUPAC name is 2-hydroxyimino-2-(4-methyl-1,3-thiazol-2-yl)acetamide;silver.
| Compound Name | 2-hydroxyimino-2-(4-methyl-1,3-thiazol-2-yl)acetamide;silver |
|---|---|
| PubChem CID | 135519768 |
| Molecular Formula | C6H7AgN3O2S |
| Molecular Weight | 293.08 g/mol |
| Exact Mass | 291.93 |
| IUPAC Name | 2-hydroxyimino-2-(4-methyl-1,3-thiazol-2-yl)acetamide;silver |
| SMILES | Cc1csc(C(=NO)C(N)=O)n1.[Ag] |
| InChI | InChI=1S/C6H7N3O2S.Ag/c1-3-2-12-6(8-3)4(9-11)5(7)10;/h2,11H,1H3,(H2,7,10); |
| InChIKey | DAPYJWZTXCXXNG-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.08 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|