C6H7Br2NOS — CID 23003355
2-bromo-1-(4-methyl-1,3-thiazol-2-yl)ethanone;hydrobromide (PubChem CID 23003355) has the molecular formula C6H7Br2NOS and a molecular weight of 301.00 g/mol. Its IUPAC name is 2-bromo-1-(4-methyl-1,3-thiazol-2-yl)ethanone;hydrobromide.
| Compound Name | 2-bromo-1-(4-methyl-1,3-thiazol-2-yl)ethanone;hydrobromide |
|---|---|
| PubChem CID | 23003355 |
| Molecular Formula | C6H7Br2NOS |
| Molecular Weight | 301.00 g/mol |
| Exact Mass | 298.86 |
| IUPAC Name | 2-bromo-1-(4-methyl-1,3-thiazol-2-yl)ethanone;hydrobromide |
| SMILES | Br.Cc1csc(C(=O)CBr)n1 |
| InChI | InChI=1S/C6H6BrNOS.BrH/c1-4-3-10-6(8-4)5(9)2-7;/h3H,2H2,1H3;1H |
| InChIKey | SRQWTORTNWOPCM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.00 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|