C20H16O2 — CID 145204602
2-[(3E,5E)-hepta-1,3,5-trien-3-yl]benzo[f]chromen-1-one (PubChem CID 145204602) has the molecular formula C20H16O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-[(3E,5E)-hepta-1,3,5-trien-3-yl]benzo[f]chromen-1-one.
| Compound Name | 2-[(3E,5E)-hepta-1,3,5-trien-3-yl]benzo[f]chromen-1-one |
|---|---|
| PubChem CID | 145204602 |
| Molecular Formula | C20H16O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 2-[(3E,5E)-hepta-1,3,5-trien-3-yl]benzo[f]chromen-1-one |
| SMILES | C=C/C(=C\C=C\C)c1coc2ccc3ccccc3c2c1=O |
| InChI | InChI=1S/C20H16O2/c1-3-5-8-14(4-2)17-13-22-18-12-11-15-9-6-7-10-16(15)19(18)20(17)21/h3-13H,2H2,1H3/b5-3+,14-8+ |
| InChIKey | GZRAZIVNZYOHIN-YUCZBXEJSA-N |
| XLogP | 5.09 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|