C20H21NO7 — CID 132572532
2-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]iminomethyl]benzo[f]chromen-1-one (PubChem CID 132572532) has the molecular formula C20H21NO7 and a molecular weight of 387.39 g/mol. Its IUPAC name is 2-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]iminomethyl]benzo[f]chromen-1-one.
| Compound Name | 2-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]iminomethyl]benzo[f]chromen-1-one |
|---|---|
| PubChem CID | 132572532 |
| Molecular Formula | C20H21NO7 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 2-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]iminomethyl]benzo[f]chromen-1-one |
| SMILES | O=c1c(/C=N/C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)coc2ccc3ccccc3c12 |
| InChI | InChI=1S/C20H21NO7/c22-9-15(24)20(27)19(26)14(23)8-21-7-12-10-28-16-6-5-11-3-1-2-4-13(11)17(16)18(12)25/h1-7,10,14-15,19-20,22-24,26-27H,8-9H2/b21-7+/t14-,15+,19+,20+/m0/s1 |
| InChIKey | GXRQSJTWQJKUTP-FYBJCSACSA-N |
| XLogP | -0.20 |
| TPSA | 143.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|