C17H21NO6 — CID 135823139
(2R,3R,4R,5S)-6-[(3-hydroxynaphthalen-2-yl)methylideneamino]hexane-1,2,3,4,5-pentol (PubChem CID 135823139) has the molecular formula C17H21NO6 and a molecular weight of 335.36 g/mol. Its IUPAC name is (2R,3R,4R,5S)-6-[(3-hydroxynaphthalen-2-yl)methylideneamino]hexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3R,4R,5S)-6-[(3-hydroxynaphthalen-2-yl)methylideneamino]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 135823139 |
| Molecular Formula | C17H21NO6 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | (2R,3R,4R,5S)-6-[(3-hydroxynaphthalen-2-yl)methylideneamino]hexane-1,2,3,4,5-pentol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C/N=C/c1cc2ccccc2cc1O |
| InChI | InChI=1S/C17H21NO6/c19-9-15(22)17(24)16(23)14(21)8-18-7-12-5-10-3-1-2-4-11(10)6-13(12)20/h1-7,14-17,19-24H,8-9H2/b18-7+/t14-,15+,16+,17+/m0/s1 |
| InChIKey | BLZDKEYFFVUROH-KCMGTEAMSA-N |
| XLogP | -0.60 |
| TPSA | 133.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|